C19H43N3 — CID 57148222
N'-[[bis(2-methylpropyl)amino]methyl]-N,N'-dibutylethane-1,2-diamine (PubChem CID 57148222) has the molecular formula C19H43N3 and a molecular weight of 313.57 g/mol. Its IUPAC name is N'-[[bis(2-methylpropyl)amino]methyl]-N,N'-dibutylethane-1,2-diamine.
| Compound Name | N'-[[bis(2-methylpropyl)amino]methyl]-N,N'-dibutylethane-1,2-diamine |
|---|---|
| PubChem CID | 57148222 |
| Molecular Formula | C19H43N3 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.35 |
| IUPAC Name | N'-[[bis(2-methylpropyl)amino]methyl]-N,N'-dibutylethane-1,2-diamine |
| SMILES | CCCCNCCN(CCCC)CN(CC(C)C)CC(C)C |
| InChI | InChI=1S/C19H43N3/c1-7-9-11-20-12-14-21(13-10-8-2)17-22(15-18(3)4)16-19(5)6/h18-20H,7-17H2,1-6H3 |
| InChIKey | OPJXAPKQXOOXON-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|