C26H40O5 — CID 57148229
methyl (2S)-2-(2-prop-2-enoxyacetyl)oxyicosa-5,8,11,14-tetraenoate (PubChem CID 57148229) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is methyl (2S)-2-(2-prop-2-enoxyacetyl)oxyicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl (2S)-2-(2-prop-2-enoxyacetyl)oxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 57148229 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | methyl (2S)-2-(2-prop-2-enoxyacetyl)oxyicosa-5,8,11,14-tetraenoate |
| SMILES | C=CCOCC(=O)O[C@@H](CCC=CCC=CCC=CCC=CCCCCC)C(=O)OC |
| InChI | InChI=1S/C26H40O5/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(26(28)29-3)31-25(27)23-30-22-5-2/h5,9-10,12-13,15-16,18-19,24H,2,4,6-8,11,14,17,20-23H2,1,3H3/t24-/m0/s1 |
| InChIKey | RUFZHAHSJMSRQZ-DEOSSOPVSA-N |
| XLogP | 6.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|