C13H22N4OS — CID 57148237
1-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]thiourea (PubChem CID 57148237) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]thiourea.
| Compound Name | 1-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]thiourea |
|---|---|
| PubChem CID | 57148237 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]thiourea |
| SMILES | CNC(=S)NCCCOCc1ncc2n1CCCC2 |
| InChI | InChI=1S/C13H22N4OS/c1-14-13(19)15-6-4-8-18-10-12-16-9-11-5-2-3-7-17(11)12/h9H,2-8,10H2,1H3,(H2,14,15,19) |
| InChIKey | WWSJZGSIKIHUNZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|