C24H21F36N3O6P3+3 — CID 57148375
2,2,4,4,6,6-hexakis(2,2,3,4,4,4-hexafluorobutoxy)-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium (PubChem CID 57148375) has the molecular formula C24H21F36N3O6P3+3 and a molecular weight of 1224.30 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis(2,2,3,4,4,4-hexafluorobutoxy)-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium.
| Compound Name | 2,2,4,4,6,6-hexakis(2,2,3,4,4,4-hexafluorobutoxy)-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium |
|---|---|
| PubChem CID | 57148375 |
| Molecular Formula | C24H21F36N3O6P3+3 |
| Molecular Weight | 1224.30 g/mol |
| Exact Mass | 1224.01 |
| IUPAC Name | 2,2,4,4,6,6-hexakis(2,2,3,4,4,4-hexafluorobutoxy)-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium |
| SMILES | FC(C(F)(F)F)C(F)(F)CO[P+]1(OCC(F)(F)C(F)C(F)(F)F)N[P+](OCC(F)(F)C(F)C(F)(F)F)(OCC(F)(F)C(F)C(F)(F)F)N[P+](OCC(F)(F)C(F)C(F)(F)F)(OCC(F)(F)C(F)C(F)(F)F)N1 |
| InChI | InChI=1S/C24H21F36N3O6P3/c25-7(19(43,44)45)13(31,32)1-64-70(65-2-14(33,34)8(26)20(46,47)48)61-71(66-3-15(35,36)9(27)21(49,50)51,67-4-16(37,38)10(28)22(52,53)54)63-72(62-70,68-5-17(39,40)11(29)23(55,56)57)69-6-18(41,42)12(30)24(58,59)60/h7-12,61-63H,1-6H2/q+3 |
| InChIKey | GWBXOOJQHQUNTD-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1224.30 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|