About 8,13-dimethylicosane-1,20-diol
8,13-dimethylicosane-1,20-diol (PubChem CID 57148401) has the molecular formula C22H46O2
and a molecular weight of 342.61 g/mol. Its IUPAC name is 8,13-dimethylicosane-1,20-diol.
Molecular Properties
| Compound Name | 8,13-dimethylicosane-1,20-diol |
| PubChem CID | 57148401 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | 8,13-dimethylicosane-1,20-diol |
| SMILES | CC(CCCCCCCO)CCCCC(C)CCCCCCCO |
| InChI | InChI=1S/C22H46O2/c1-21(15-9-5-3-7-13-19-23)17-11-12-18-22(2)16-10-6-4-8-14-20-24/h21-24H,3-20H2,1-2H3 |
| InChIKey | SBERLKNFEOUTCY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8,13-dimethylicosane-1,20-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,13-dimethylicosane-1,20-diol?
The IUPAC name of 8,13-dimethylicosane-1,20-diol (CID 57148401) is 8,13-dimethylicosane-1,20-diol.
What is the SMILES notation for 8,13-dimethylicosane-1,20-diol?
The canonical SMILES for 8,13-dimethylicosane-1,20-diol is CC(CCCCCCCO)CCCCC(C)CCCCCCCO.
What is the InChIKey of 8,13-dimethylicosane-1,20-diol?
The InChIKey is SBERLKNFEOUTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O2/c1-21(15-9-5-3-7-13-19-23)17-11-12-18-22(2)16-10-6-4-8-14-20-24/h21-24H,3-20H2,1-2H3.
What are the key properties of 8,13-dimethylicosane-1,20-diol?
8,13-dimethylicosane-1,20-diol has a molecular weight of 342.61 g/mol, XLogP of 6.48, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,13-dimethylicosane-1,20-diol is sourced from PubChem (CID 57148401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).