About 2-azidopropane-1,1,1,2-tetrol
2-azidopropane-1,1,1,2-tetrol (PubChem CID 57148541) has the molecular formula C3H7N3O4
and a molecular weight of 149.11 g/mol. Its IUPAC name is 2-azidopropane-1,1,1,2-tetrol.
Molecular Properties
| Compound Name | 2-azidopropane-1,1,1,2-tetrol |
| PubChem CID | 57148541 |
| Molecular Formula | C3H7N3O4 |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | 2-azidopropane-1,1,1,2-tetrol |
| SMILES | CC(O)(N=[N+]=[N-])C(O)(O)O |
| InChI | InChI=1S/C3H7N3O4/c1-2(7,5-6-4)3(8,9)10/h7-10H,1H3 |
| InChIKey | SDLJPJWQQRMVCY-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 129.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidopropane-1,1,1,2-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidopropane-1,1,1,2-tetrol?
The IUPAC name of 2-azidopropane-1,1,1,2-tetrol (CID 57148541) is 2-azidopropane-1,1,1,2-tetrol.
What is the SMILES notation for 2-azidopropane-1,1,1,2-tetrol?
The canonical SMILES for 2-azidopropane-1,1,1,2-tetrol is CC(O)(N=[N+]=[N-])C(O)(O)O.
What is the InChIKey of 2-azidopropane-1,1,1,2-tetrol?
The InChIKey is SDLJPJWQQRMVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O4/c1-2(7,5-6-4)3(8,9)10/h7-10H,1H3.
What are the key properties of 2-azidopropane-1,1,1,2-tetrol?
2-azidopropane-1,1,1,2-tetrol has a molecular weight of 149.11 g/mol, XLogP of -1.36, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidopropane-1,1,1,2-tetrol is sourced from PubChem (CID 57148541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).