C24H40N2O6Si — CID 57149371
prop-2-enyl (3R)-3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]morpholine-4-carboxylate (PubChem CID 57149371) has the molecular formula C24H40N2O6Si and a molecular weight of 480.68 g/mol. Its IUPAC name is prop-2-enyl (3R)-3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]morpholine-4-carboxylate.
| Compound Name | prop-2-enyl (3R)-3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 57149371 |
| Molecular Formula | C24H40N2O6Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | prop-2-enyl (3R)-3-[4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]morpholine-4-carboxylate |
| SMILES | C=CCOC(=O)N1CCOC[C@H]1C=C(C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40N2O6Si/c1-9-11-31-23(29)26-10-12-30-15-18(26)13-16(2)20(27)14-19-21(22(28)25-19)17(3)32-33(7,8)24(4,5)6/h9,13,17-19,21H,1,10-12,14-15H2,2-8H3,(H,25,28)/t17-,18-,19-,21-/m1/s1 |
| InChIKey | SQHWTUPOAOHBGC-ANTGDGSKSA-N |
| XLogP | 3.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|