C9H13N3O2S — CID 57149872
1-[4-(2-aminoethoxy)phenyl]-1-sulfanylurea (PubChem CID 57149872) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 1-[4-(2-aminoethoxy)phenyl]-1-sulfanylurea.
| Compound Name | 1-[4-(2-aminoethoxy)phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 57149872 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-[4-(2-aminoethoxy)phenyl]-1-sulfanylurea |
| SMILES | NCCOc1ccc(N(S)C(N)=O)cc1 |
| InChI | InChI=1S/C9H13N3O2S/c10-5-6-14-8-3-1-7(2-4-8)12(15)9(11)13/h1-4,15H,5-6,10H2,(H2,11,13) |
| InChIKey | FBDORLHLLYFZSZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|