C19H28O8 — CID 57150004
[2-methyl-10-oxo-7,8-di(propanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] propanoate (PubChem CID 57150004) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-methyl-10-oxo-7,8-di(propanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] propanoate.
| Compound Name | [2-methyl-10-oxo-7,8-di(propanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] propanoate |
|---|---|
| PubChem CID | 57150004 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [2-methyl-10-oxo-7,8-di(propanoyloxy)-2,3,4,7,8,9-hexahydrooxecin-4-yl] propanoate |
| SMILES | CCC(=O)OC1C=CC(OC(=O)CC)C(OC(=O)CC)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C19H28O8/c1-5-16(20)25-13-8-9-14(26-17(21)6-2)15(27-18(22)7-3)11-19(23)24-12(4)10-13/h8-9,12-15H,5-7,10-11H2,1-4H3 |
| InChIKey | ADRRJSYFCSDROI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|