C34H41NO4 — CID 57150137
2-[2-[(3aR,4S,5S,6aS)-5-hydroxy-4-(4-methyl-3-oxooct-1-en-6-ynyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]-N-benzyl-N-phenylacetamide (PubChem CID 57150137) has the molecular formula C34H41NO4 and a molecular weight of 527.71 g/mol. Its IUPAC name is 2-[2-[(3aR,4S,5S,6aS)-5-hydroxy-4-(4-methyl-3-oxooct-1-en-6-ynyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]-N-benzyl-N-phenylacetamide.
| Compound Name | 2-[2-[(3aR,4S,5S,6aS)-5-hydroxy-4-(4-methyl-3-oxooct-1-en-6-ynyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]-N-benzyl-N-phenylacetamide |
|---|---|
| PubChem CID | 57150137 |
| Molecular Formula | C34H41NO4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | 2-[2-[(3aR,4S,5S,6aS)-5-hydroxy-4-(4-methyl-3-oxooct-1-en-6-ynyl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethoxy]-N-benzyl-N-phenylacetamide |
| SMILES | CC#CCC(C)C(=O)C=C[C@H]1[C@@H]2CC(CCOCC(=O)N(Cc3ccccc3)c3ccccc3)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C34H41NO4/c1-3-4-11-25(2)32(36)17-16-30-31-21-27(20-28(31)22-33(30)37)18-19-39-24-34(38)35(29-14-9-6-10-15-29)23-26-12-7-5-8-13-26/h5-10,12-17,25,27-28,30-31,33,37H,11,18-24H2,1-2H3/t25?,27?,28-,30-,31+,33-/m0/s1 |
| InChIKey | BMKPLIIQRBJWEH-KMGCVSNYSA-N |
| XLogP | 5.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|