C15H14FNO4S — CID 57150178
3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide (PubChem CID 57150178) has the molecular formula C15H14FNO4S and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57150178 |
| Molecular Formula | C15H14FNO4S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide |
| SMILES | COc1ccc(C(=O)Cc2cccc(S(N)(=O)=O)c2)cc1F |
| InChI | InChI=1S/C15H14FNO4S/c1-21-15-6-5-11(9-13(15)16)14(18)8-10-3-2-4-12(7-10)22(17,19)20/h2-7,9H,8H2,1H3,(H2,17,19,20) |
| InChIKey | RQZGUDDCPJJHQY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |