C18H25FNO2S+ — CID 57150229
methyl (2S,3S)-3-(4-fluorophenyl)-8-methyl-8-(2-sulfanylethyl)-8-azoniabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 57150229) has the molecular formula C18H25FNO2S+ and a molecular weight of 338.47 g/mol. Its IUPAC name is methyl (2S,3S)-3-(4-fluorophenyl)-8-methyl-8-(2-sulfanylethyl)-8-azoniabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-(4-fluorophenyl)-8-methyl-8-(2-sulfanylethyl)-8-azoniabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 57150229 |
| Molecular Formula | C18H25FNO2S+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | methyl (2S,3S)-3-(4-fluorophenyl)-8-methyl-8-(2-sulfanylethyl)-8-azoniabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C2CCC(C[C@@H]1c1ccc(F)cc1)[N+]2(C)CCS |
| InChI | InChI=1S/C18H24FNO2S/c1-20(9-10-23)14-7-8-16(20)17(18(21)22-2)15(11-14)12-3-5-13(19)6-4-12/h3-6,14-17H,7-11H2,1-2H3/p+1/t14?,15-,16?,17+,20?/m1/s1 |
| InChIKey | XYJJJPSLWVDNMF-LQVNDMKBSA-O |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|