About 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate
3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate (PubChem CID 57150407) has the molecular formula C25H40O13
and a molecular weight of 548.58 g/mol. Its IUPAC name is 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate.
Molecular Properties
| Compound Name | 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate |
| PubChem CID | 57150407 |
| Molecular Formula | C25H40O13 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OCCCOCC(OCCCOC(=O)C(=O)CC)C(CO)OCCCOC(=O)C(=O)CC |
| InChI | InChI=1S/C25H40O13/c1-4-18(27)23(30)36-13-7-10-33-17-22(35-12-9-15-38-25(32)20(29)6-3)21(16-26)34-11-8-14-37-24(31)19(28)5-2/h21-22,26H,4-17H2,1-3H3 |
| InChIKey | ZHJMSJNOFSKFHH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate?
The IUPAC name of 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate (CID 57150407) is 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate.
What is the SMILES notation for 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate?
The canonical SMILES for 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate is CCC(=O)C(=O)OCCCOCC(OCCCOC(=O)C(=O)CC)C(CO)OCCCOC(=O)C(=O)CC.
What is the InChIKey of 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate?
The InChIKey is ZHJMSJNOFSKFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O13/c1-4-18(27)23(30)36-13-7-10-33-17-22(35-12-9-15-38-25(32)20(29)6-3)21(16-26)34-11-8-14-37-24(31)19(28)5-2/h21-22,26H,4-17H2,1-3H3.
What are the key properties of 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate?
3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate has a molecular weight of 548.58 g/mol, XLogP of 0.50, 24 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-hydroxy-2,3-bis[3-(2-oxobutanoyloxy)propoxy]butoxy]propyl 2-oxobutanoate is sourced from PubChem (CID 57150407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).