About methyl 2-anilinoacetate
methyl 2-anilinoacetate (PubChem CID 571509) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 2-anilinoacetate.
Molecular Properties
| Compound Name | methyl 2-anilinoacetate |
| PubChem CID | 571509 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 2-anilinoacetate |
| SMILES | COC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c1-12-9(11)7-10-8-5-3-2-4-6-8/h2-6,10H,7H2,1H3 |
| InChIKey | SZJUWKPNWWCOPG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-anilinoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-anilinoacetate?
The IUPAC name of methyl 2-anilinoacetate (CID 571509) is methyl 2-anilinoacetate.
What is the SMILES notation for methyl 2-anilinoacetate?
The canonical SMILES for methyl 2-anilinoacetate is COC(=O)CNc1ccccc1.
What is the InChIKey of methyl 2-anilinoacetate?
The InChIKey is SZJUWKPNWWCOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-12-9(11)7-10-8-5-3-2-4-6-8/h2-6,10H,7H2,1H3.
What are the key properties of methyl 2-anilinoacetate?
methyl 2-anilinoacetate has a molecular weight of 165.19 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-anilinoacetate is sourced from PubChem (CID 571509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).