About 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate
2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 57150987) has the molecular formula C14H19NO3S2
and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate |
| PubChem CID | 57150987 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | CC1=C(CCOS(=O)(=O)c2ccc(C)cc2)SCN1C |
| InChI | InChI=1S/C14H19NO3S2/c1-11-4-6-13(7-5-11)20(16,17)18-9-8-14-12(2)15(3)10-19-14/h4-7H,8-10H2,1-3H3 |
| InChIKey | BKOZGYAXYBALPS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate (CID 57150987) is 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate is CC1=C(CCOS(=O)(=O)c2ccc(C)cc2)SCN1C.
What is the InChIKey of 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate?
The InChIKey is BKOZGYAXYBALPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3S2/c1-11-4-6-13(7-5-11)20(16,17)18-9-8-14-12(2)15(3)10-19-14/h4-7H,8-10H2,1-3H3.
What are the key properties of 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate?
2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate has a molecular weight of 313.44 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethyl-2H-1,3-thiazol-5-yl)ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 57150987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).