About 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid
2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid (PubChem CID 57151084) has the molecular formula C6H5F3O4
and a molecular weight of 198.10 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid |
| PubChem CID | 57151084 |
| Molecular Formula | C6H5F3O4 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid |
| SMILES | CC=C(OC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H5F3O4/c1-2-3(4(10)11)13-5(12)6(7,8)9/h2H,1H3,(H,10,11) |
| InChIKey | KWSFLVCFRVRXSV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid?
The IUPAC name of 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid (CID 57151084) is 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid.
What is the SMILES notation for 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid?
The canonical SMILES for 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid is CC=C(OC(=O)C(F)(F)F)C(=O)O.
What is the InChIKey of 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid?
The InChIKey is KWSFLVCFRVRXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3O4/c1-2-3(4(10)11)13-5(12)6(7,8)9/h2H,1H3,(H,10,11).
What are the key properties of 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid?
2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid has a molecular weight of 198.10 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroacetyl)oxybut-2-enoic acid is sourced from PubChem (CID 57151084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).