About (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid
(2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid (PubChem CID 57151260) has the molecular formula C21H36NO4+
and a molecular weight of 366.52 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid |
| PubChem CID | 57151260 |
| Molecular Formula | C21H36NO4+ |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid |
| SMILES | CCC[N+]1(C(=O)C(=O)C(C)(C)CC)CCC(C2CCCCC2)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H35NO4/c1-5-13-22(19(24)18(23)21(3,4)6-2)14-12-16(17(22)20(25)26)15-10-8-7-9-11-15/h15-17H,5-14H2,1-4H3/p+1/t16?,17-,22?/m0/s1 |
| InChIKey | OQBVLGGJCRANDK-JQHMZKTJSA-O |
| XLogP | 3.80 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid?
The IUPAC name of (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid (CID 57151260) is (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid.
What is the SMILES notation for (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid?
The canonical SMILES for (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid is CCC[N+]1(C(=O)C(=O)C(C)(C)CC)CCC(C2CCCCC2)[C@H]1C(=O)O.
What is the InChIKey of (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid?
The InChIKey is OQBVLGGJCRANDK-JQHMZKTJSA-O. The full InChI is InChI=1S/C21H35NO4/c1-5-13-22(19(24)18(23)21(3,4)6-2)14-12-16(17(22)20(25)26)15-10-8-7-9-11-15/h15-17H,5-14H2,1-4H3/p+1/t16?,17-,22?/m0/s1.
What are the key properties of (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid?
(2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid has a molecular weight of 366.52 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-cyclohexyl-1-(3,3-dimethyl-2-oxopentanoyl)-1-propylpyrrolidin-1-ium-2-carboxylic acid is sourced from PubChem (CID 57151260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).