About (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid
(2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 57151394) has the molecular formula C21H25NO4
and a molecular weight of 355.43 g/mol. Its IUPAC name is (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 57151394 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C(O)(C(=O)[C@@]1(C(=O)O)CCCN1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H25NO4/c1-19(2,3)21(26,17(23)20(18(24)25)11-6-12-22-20)16-10-9-14-7-4-5-8-15(14)13-16/h4-5,7-10,13,22,26H,6,11-12H2,1-3H3,(H,24,25)/t20-,21?/m1/s1 |
| InChIKey | FZQVLNCIYFXLNW-VQCQRNETSA-N |
| XLogP | 2.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid (CID 57151394) is (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid is CC(C)(C)C(O)(C(=O)[C@@]1(C(=O)O)CCCN1)c1ccc2ccccc2c1.
What is the InChIKey of (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid?
The InChIKey is FZQVLNCIYFXLNW-VQCQRNETSA-N. The full InChI is InChI=1S/C21H25NO4/c1-19(2,3)21(26,17(23)20(18(24)25)11-6-12-22-20)16-10-9-14-7-4-5-8-15(14)13-16/h4-5,7-10,13,22,26H,6,11-12H2,1-3H3,(H,24,25)/t20-,21?/m1/s1.
What are the key properties of (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid?
(2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid has a molecular weight of 355.43 g/mol, XLogP of 2.85, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2-hydroxy-3,3-dimethyl-2-naphthalen-2-ylbutanoyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 57151394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).