C25H26N2O6 — CID 57151569
(4-methoxyphenyl)methyl N-[3-[[4-(aminomethyl)phenyl]methoxy]-4-methoxybenzoyl]carbamate (PubChem CID 57151569) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[3-[[4-(aminomethyl)phenyl]methoxy]-4-methoxybenzoyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[3-[[4-(aminomethyl)phenyl]methoxy]-4-methoxybenzoyl]carbamate |
|---|---|
| PubChem CID | 57151569 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[3-[[4-(aminomethyl)phenyl]methoxy]-4-methoxybenzoyl]carbamate |
| SMILES | COc1ccc(COC(=O)NC(=O)c2ccc(OC)c(OCc3ccc(CN)cc3)c2)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-30-21-10-7-19(8-11-21)16-33-25(29)27-24(28)20-9-12-22(31-2)23(13-20)32-15-18-5-3-17(14-26)4-6-18/h3-13H,14-16,26H2,1-2H3,(H,27,28,29) |
| InChIKey | DCAXOAZBSDPJKW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |