About 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide
2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide (PubChem CID 57151966) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide |
| PubChem CID | 57151966 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CNc1ccnc2cccnc12 |
| InChI | InChI=1S/C16H22N4O/c1-3-10-20(11-4-2)15(21)12-19-14-7-9-17-13-6-5-8-18-16(13)14/h5-9H,3-4,10-12H2,1-2H3,(H,17,19) |
| InChIKey | XDEXJNJSZXKWIW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide?
The IUPAC name of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide (CID 57151966) is 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide.
What is the SMILES notation for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide?
The canonical SMILES for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide is CCCN(CCC)C(=O)CNc1ccnc2cccnc12.
What is the InChIKey of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide?
The InChIKey is XDEXJNJSZXKWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-3-10-20(11-4-2)15(21)12-19-14-7-9-17-13-6-5-8-18-16(13)14/h5-9H,3-4,10-12H2,1-2H3,(H,17,19).
What are the key properties of 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide?
2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide has a molecular weight of 286.38 g/mol, XLogP of 2.69, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-naphthyridin-4-ylamino)-N,N-dipropylacetamide is sourced from PubChem (CID 57151966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).