About 3H-pyrazino[2,3-d]quinoline
3H-pyrazino[2,3-d]quinoline (PubChem CID 57152003) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3H-pyrazino[2,3-d]quinoline.
Molecular Properties
| Compound Name | 3H-pyrazino[2,3-d]quinoline |
| PubChem CID | 57152003 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3H-pyrazino[2,3-d]quinoline |
| SMILES | C1=CC2=NC=CC3=NCC=NC23C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-5-11-9(3-1)12-6-4-10(11)13-7-8-14-11/h1-6,8H,7H2 |
| InChIKey | IUGCHFWYZFFTFL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-pyrazino[2,3-d]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrazino[2,3-d]quinoline?
The IUPAC name of 3H-pyrazino[2,3-d]quinoline (CID 57152003) is 3H-pyrazino[2,3-d]quinoline.
What is the SMILES notation for 3H-pyrazino[2,3-d]quinoline?
The canonical SMILES for 3H-pyrazino[2,3-d]quinoline is C1=CC2=NC=CC3=NCC=NC23C=C1.
What is the InChIKey of 3H-pyrazino[2,3-d]quinoline?
The InChIKey is IUGCHFWYZFFTFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-5-11-9(3-1)12-6-4-10(11)13-7-8-14-11/h1-6,8H,7H2.
What are the key properties of 3H-pyrazino[2,3-d]quinoline?
3H-pyrazino[2,3-d]quinoline has a molecular weight of 183.21 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrazino[2,3-d]quinoline is sourced from PubChem (CID 57152003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).