About 6-chloro-5H-indeno[1,2-d][1,3]dioxole
6-chloro-5H-indeno[1,2-d][1,3]dioxole (PubChem CID 57152058) has the molecular formula C10H7ClO2
and a molecular weight of 194.62 g/mol. Its IUPAC name is 6-chloro-5H-indeno[1,2-d][1,3]dioxole.
Molecular Properties
| Compound Name | 6-chloro-5H-indeno[1,2-d][1,3]dioxole |
| PubChem CID | 57152058 |
| Molecular Formula | C10H7ClO2 |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 6-chloro-5H-indeno[1,2-d][1,3]dioxole |
| SMILES | ClC1=CC=C2C(=CC3=C2OCO3)C1 |
| InChI | InChI=1S/C10H7ClO2/c11-7-1-2-8-6(3-7)4-9-10(8)13-5-12-9/h1-2,4H,3,5H2 |
| InChIKey | FAOURDWRKRPRRK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-5H-indeno[1,2-d][1,3]dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5H-indeno[1,2-d][1,3]dioxole?
The IUPAC name of 6-chloro-5H-indeno[1,2-d][1,3]dioxole (CID 57152058) is 6-chloro-5H-indeno[1,2-d][1,3]dioxole.
What is the SMILES notation for 6-chloro-5H-indeno[1,2-d][1,3]dioxole?
The canonical SMILES for 6-chloro-5H-indeno[1,2-d][1,3]dioxole is ClC1=CC=C2C(=CC3=C2OCO3)C1.
What is the InChIKey of 6-chloro-5H-indeno[1,2-d][1,3]dioxole?
The InChIKey is FAOURDWRKRPRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClO2/c11-7-1-2-8-6(3-7)4-9-10(8)13-5-12-9/h1-2,4H,3,5H2.
What are the key properties of 6-chloro-5H-indeno[1,2-d][1,3]dioxole?
6-chloro-5H-indeno[1,2-d][1,3]dioxole has a molecular weight of 194.62 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5H-indeno[1,2-d][1,3]dioxole is sourced from PubChem (CID 57152058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).