About (3S,4S)-3,4-dibromothiolane
(3S,4S)-3,4-dibromothiolane (PubChem CID 57152374) has the molecular formula C4H6Br2S
and a molecular weight of 245.97 g/mol. Its IUPAC name is (3S,4S)-3,4-dibromothiolane.
Molecular Properties
| Compound Name | (3S,4S)-3,4-dibromothiolane |
| PubChem CID | 57152374 |
| Molecular Formula | C4H6Br2S |
| Molecular Weight | 245.97 g/mol |
| Exact Mass | 243.86 |
| IUPAC Name | (3S,4S)-3,4-dibromothiolane |
| SMILES | Br[C@H]1CSC[C@@H]1Br |
| InChI | InChI=1S/C4H6Br2S/c5-3-1-7-2-4(3)6/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | GLWOMQDLTCKUSP-IMJSIDKUSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.97 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3,4-dibromothiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-dibromothiolane?
The IUPAC name of (3S,4S)-3,4-dibromothiolane (CID 57152374) is (3S,4S)-3,4-dibromothiolane.
What is the SMILES notation for (3S,4S)-3,4-dibromothiolane?
The canonical SMILES for (3S,4S)-3,4-dibromothiolane is Br[C@H]1CSC[C@@H]1Br.
What is the InChIKey of (3S,4S)-3,4-dibromothiolane?
The InChIKey is GLWOMQDLTCKUSP-IMJSIDKUSA-N. The full InChI is InChI=1S/C4H6Br2S/c5-3-1-7-2-4(3)6/h3-4H,1-2H2/t3-,4-/m0/s1.
What are the key properties of (3S,4S)-3,4-dibromothiolane?
(3S,4S)-3,4-dibromothiolane has a molecular weight of 245.97 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-dibromothiolane is sourced from PubChem (CID 57152374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).