About 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one
2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one (PubChem CID 57152651) has the molecular formula C22H30F2O2
and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one |
| PubChem CID | 57152651 |
| Molecular Formula | C22H30F2O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one |
| SMILES | CC(C)C[C@@H](C)C(F)(F)C(=O)CCC1CCC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H30F2O2/c1-15(2)13-16(3)22(23,24)21(26)12-10-18-9-11-20(25)19(18)14-17-7-5-4-6-8-17/h4-8,15-16,18-19H,9-14H2,1-3H3/t16-,18?,19?/m1/s1 |
| InChIKey | XDZNDTABVKEPQG-IPJUCJBFSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one?
The IUPAC name of 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one (CID 57152651) is 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one.
What is the SMILES notation for 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one?
The canonical SMILES for 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one is CC(C)C[C@@H](C)C(F)(F)C(=O)CCC1CCC(=O)C1Cc1ccccc1.
What is the InChIKey of 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one?
The InChIKey is XDZNDTABVKEPQG-IPJUCJBFSA-N. The full InChI is InChI=1S/C22H30F2O2/c1-15(2)13-16(3)22(23,24)21(26)12-10-18-9-11-20(25)19(18)14-17-7-5-4-6-8-17/h4-8,15-16,18-19H,9-14H2,1-3H3/t16-,18?,19?/m1/s1.
What are the key properties of 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one?
2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one has a molecular weight of 364.48 g/mol, XLogP of 5.49, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooctyl]cyclopentan-1-one is sourced from PubChem (CID 57152651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).