C33H60F2O5Si2 — CID 57152907
methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(1-fluorocyclopentyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate (PubChem CID 57152907) has the molecular formula C33H60F2O5Si2 and a molecular weight of 631.01 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(1-fluorocyclopentyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate.
| Compound Name | methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(1-fluorocyclopentyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate |
|---|---|
| PubChem CID | 57152907 |
| Molecular Formula | C33H60F2O5Si2 |
| Molecular Weight | 631.01 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(1-fluorocyclopentyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate |
| SMILES | COC(=O)CCCC=CC(F)[C@H]1[C@@H](C=CC(O[Si](C)(C)C(C)(C)C)C2(F)CCCC2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C33H60F2O5Si2/c1-31(2,3)41(8,9)39-27-23-26(36)30(25(34)17-13-12-14-18-29(37)38-7)24(27)19-20-28(33(35)21-15-16-22-33)40-42(10,11)32(4,5)6/h13,17,19-20,24-28,30,36H,12,14-16,18,21-23H2,1-11H3/t24-,25?,26-,27+,28?,30+/m0/s1 |
| InChIKey | CTRJICOLVTZFDK-NTHDVEJNSA-N |
| XLogP | 8.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.01 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|