C28H56O3Si2 — CID 57153383
(7R)-7-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methylideneoctan-1-ol (PubChem CID 57153383) has the molecular formula C28H56O3Si2 and a molecular weight of 496.93 g/mol. Its IUPAC name is (7R)-7-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methylideneoctan-1-ol.
| Compound Name | (7R)-7-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methylideneoctan-1-ol |
|---|---|
| PubChem CID | 57153383 |
| Molecular Formula | C28H56O3Si2 |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | (7R)-7-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-[tert-butyl(dimethyl)silyl]oxy-2-methylideneoctan-1-ol |
| SMILES | C=C(CO)CC(CC[C@@H](C)[C@H]1CCC2C(O[Si](C)(C)C)CCC[C@@]21C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O3Si2/c1-21(20-29)19-23(30-33(10,11)27(3,4)5)15-14-22(2)24-16-17-25-26(31-32(7,8)9)13-12-18-28(24,25)6/h22-26,29H,1,12-20H2,2-11H3/t22-,23?,24-,25?,26?,28-/m1/s1 |
| InChIKey | RNDOBKIWZTYRFH-YMHVILEVSA-N |
| XLogP | 8.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|