About 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal
3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal (PubChem CID 57153399) has the molecular formula C13H12Cl2O3
and a molecular weight of 287.14 g/mol. Its IUPAC name is 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal.
Molecular Properties
| Compound Name | 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal |
| PubChem CID | 57153399 |
| Molecular Formula | C13H12Cl2O3 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal |
| SMILES | O=CC(=O)Cc1ccc(OCC2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H12Cl2O3/c14-13(15)6-10(13)8-18-12-3-1-9(2-4-12)5-11(17)7-16/h1-4,7,10H,5-6,8H2 |
| InChIKey | QMWCJMIKWGZORV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal?
The IUPAC name of 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal (CID 57153399) is 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal.
What is the SMILES notation for 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal?
The canonical SMILES for 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal is O=CC(=O)Cc1ccc(OCC2CC2(Cl)Cl)cc1.
What is the InChIKey of 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal?
The InChIKey is QMWCJMIKWGZORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2O3/c14-13(15)6-10(13)8-18-12-3-1-9(2-4-12)5-11(17)7-16/h1-4,7,10H,5-6,8H2.
What are the key properties of 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal?
3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal has a molecular weight of 287.14 g/mol, XLogP of 2.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]-2-oxopropanal is sourced from PubChem (CID 57153399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).