C12H12ClF7O3 — CID 57153720
3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57153720) has the molecular formula C12H12ClF7O3 and a molecular weight of 372.66 g/mol. Its IUPAC name is 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57153720 |
| Molecular Formula | C12H12ClF7O3 |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)OCC(F)(F)C(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C12H12ClF7O3/c1-9(2)5(7(9)8(21)22)3-6(13)11(16,17)23-4-10(14,15)12(18,19)20/h3,5,7H,4H2,1-2H3,(H,21,22) |
| InChIKey | DXMNZGUFLNXFLR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|