About (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol
(2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol (PubChem CID 57153789) has the molecular formula C16H22N4O3
and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol.
Molecular Properties
| Compound Name | (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol |
| PubChem CID | 57153789 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol |
| SMILES | C[C@H](O)[C@@H](O)COc1nc(N2CCNCC2)nc2ccccc12 |
| InChI | InChI=1S/C16H22N4O3/c1-11(21)14(22)10-23-15-12-4-2-3-5-13(12)18-16(19-15)20-8-6-17-7-9-20/h2-5,11,14,17,21-22H,6-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | SFCUSBUVMMYLAG-FZMZJTMJSA-N |
| XLogP | 0.16 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol?
The IUPAC name of (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol (CID 57153789) is (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol.
What is the SMILES notation for (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol?
The canonical SMILES for (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol is C[C@H](O)[C@@H](O)COc1nc(N2CCNCC2)nc2ccccc12.
What is the InChIKey of (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol?
The InChIKey is SFCUSBUVMMYLAG-FZMZJTMJSA-N. The full InChI is InChI=1S/C16H22N4O3/c1-11(21)14(22)10-23-15-12-4-2-3-5-13(12)18-16(19-15)20-8-6-17-7-9-20/h2-5,11,14,17,21-22H,6-10H2,1H3/t11-,14-/m0/s1.
What are the key properties of (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol?
(2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol has a molecular weight of 318.38 g/mol, XLogP of 0.16, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-1-(2-piperazin-1-ylquinazolin-4-yl)oxybutane-2,3-diol is sourced from PubChem (CID 57153789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).