About 1-propan-2-yldiazepane
1-propan-2-yldiazepane (PubChem CID 57154820) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-propan-2-yldiazepane.
Molecular Properties
| Compound Name | 1-propan-2-yldiazepane |
| PubChem CID | 57154820 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-propan-2-yldiazepane |
| SMILES | CC(C)N1CCCCCN1 |
| InChI | InChI=1S/C8H18N2/c1-8(2)10-7-5-3-4-6-9-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | NFCLTKURMURIMC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propan-2-yldiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yldiazepane?
The IUPAC name of 1-propan-2-yldiazepane (CID 57154820) is 1-propan-2-yldiazepane.
What is the SMILES notation for 1-propan-2-yldiazepane?
The canonical SMILES for 1-propan-2-yldiazepane is CC(C)N1CCCCCN1.
What is the InChIKey of 1-propan-2-yldiazepane?
The InChIKey is NFCLTKURMURIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-8(2)10-7-5-3-4-6-9-10/h8-9H,3-7H2,1-2H3.
What are the key properties of 1-propan-2-yldiazepane?
1-propan-2-yldiazepane has a molecular weight of 142.25 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yldiazepane is sourced from PubChem (CID 57154820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).