C17H10O2 — CID 57154843
3-[(2R,3R)-3-(6-phenylhexa-1,3,5-triynyl)oxiran-2-yl]prop-2-enal (PubChem CID 57154843) has the molecular formula C17H10O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-[(2R,3R)-3-(6-phenylhexa-1,3,5-triynyl)oxiran-2-yl]prop-2-enal.
| Compound Name | 3-[(2R,3R)-3-(6-phenylhexa-1,3,5-triynyl)oxiran-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 57154843 |
| Molecular Formula | C17H10O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-[(2R,3R)-3-(6-phenylhexa-1,3,5-triynyl)oxiran-2-yl]prop-2-enal |
| SMILES | O=CC=C[C@H]1O[C@@H]1C#CC#CC#Cc1ccccc1 |
| InChI | InChI=1S/C17H10O2/c18-14-8-13-17-16(19-17)12-7-2-1-4-9-15-10-5-3-6-11-15/h3,5-6,8,10-11,13-14,16-17H/t16-,17-/m1/s1 |
| InChIKey | OKTSPMQVVJFSGM-IAGOWNOFSA-N |
| XLogP | 1.57 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|