C17H10Cl4O3 — CID 57154912
4,5,6,7-tetrachloro-3-[2-(4-methoxyphenyl)ethenyl]-3H-2-benzofuran-1-one (PubChem CID 57154912) has the molecular formula C17H10Cl4O3 and a molecular weight of 404.08 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3-[2-(4-methoxyphenyl)ethenyl]-3H-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3-[2-(4-methoxyphenyl)ethenyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 57154912 |
| Molecular Formula | C17H10Cl4O3 |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 4,5,6,7-tetrachloro-3-[2-(4-methoxyphenyl)ethenyl]-3H-2-benzofuran-1-one |
| SMILES | COc1ccc(C=CC2OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C17H10Cl4O3/c1-23-9-5-2-8(3-6-9)4-7-10-11-12(17(22)24-10)14(19)16(21)15(20)13(11)18/h2-7,10H,1H3 |
| InChIKey | IHUKQXJUULUVDJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|