C11H18ClN3O6 — CID 57154919
1-(2-chloroethyl)-1-nitroso-3-prop-2-enyl-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]urea (PubChem CID 57154919) has the molecular formula C11H18ClN3O6 and a molecular weight of 323.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-prop-2-enyl-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-prop-2-enyl-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
|---|---|
| PubChem CID | 57154919 |
| Molecular Formula | C11H18ClN3O6 |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-prop-2-enyl-3-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
| SMILES | C=CCN(C(=O)N(CCCl)N=O)[C@@H]1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18ClN3O6/c1-2-4-14(11(19)15(13-20)5-3-12)10-9(18)8(17)7(16)6-21-10/h2,7-10,16-18H,1,3-6H2/t7-,8-,9+,10-/m1/s1 |
| InChIKey | NWHBEOZVNMELBC-DOLQZWNJSA-N |
| XLogP | -0.74 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|