About 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline
4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline (PubChem CID 57154920) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline.
Molecular Properties
| Compound Name | 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline |
| PubChem CID | 57154920 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline |
| SMILES | Nc1ccc(-c2ccc3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C15H16N2/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)17-15/h5-10H,1-4,16H2 |
| InChIKey | JZJCKFMRLBQPAD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline?
The IUPAC name of 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline (CID 57154920) is 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline.
What is the SMILES notation for 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline?
The canonical SMILES for 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline is Nc1ccc(-c2ccc3c(n2)CCCC3)cc1.
What is the InChIKey of 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline?
The InChIKey is JZJCKFMRLBQPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)17-15/h5-10H,1-4,16H2.
What are the key properties of 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline?
4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline has a molecular weight of 224.31 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6,7,8-tetrahydroquinolin-2-yl)aniline is sourced from PubChem (CID 57154920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).