C27H35NO8 — CID 57155045
2-[N-ethoxy-3-methoxy-2-prop-2-enoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]anilino]acetaldehyde (PubChem CID 57155045) has the molecular formula C27H35NO8 and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-[N-ethoxy-3-methoxy-2-prop-2-enoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]anilino]acetaldehyde.
| Compound Name | 2-[N-ethoxy-3-methoxy-2-prop-2-enoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]anilino]acetaldehyde |
|---|---|
| PubChem CID | 57155045 |
| Molecular Formula | C27H35NO8 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-[N-ethoxy-3-methoxy-2-prop-2-enoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]anilino]acetaldehyde |
| SMILES | C=CCOc1c(OC)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1N(CC=O)OCC |
| InChI | InChI=1S/C27H35NO8/c1-7-13-34-26-20(28(11-12-29)35-8-2)14-18(15-23(26)30-3)21-9-10-22(36-21)19-16-24(31-4)27(33-6)25(17-19)32-5/h7,12,14-17,21-22H,1,8-11,13H2,2-6H3 |
| InChIKey | ZYQMFRUWTGFYJS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|