C25H26O4 — CID 57155261
(2S,3S,5S)-2-(1-hydroxy-2,2,2-triphenylethyl)-5-methoxyoxolan-3-ol (PubChem CID 57155261) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S,3S,5S)-2-(1-hydroxy-2,2,2-triphenylethyl)-5-methoxyoxolan-3-ol.
| Compound Name | (2S,3S,5S)-2-(1-hydroxy-2,2,2-triphenylethyl)-5-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 57155261 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2S,3S,5S)-2-(1-hydroxy-2,2,2-triphenylethyl)-5-methoxyoxolan-3-ol |
| SMILES | CO[C@@H]1C[C@H](O)[C@@H](C(O)C(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C25H26O4/c1-28-22-17-21(26)23(29-22)24(27)25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21-24,26-27H,17H2,1H3/t21-,22-,23-,24?/m0/s1 |
| InChIKey | AYKGJAOMZKJQAU-UYRQCKRZSA-N |
| XLogP | 3.50 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|