C22H32N2O2 — CID 57155393
(8aS,12aS,13aS)-3-hexoxy-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 57155393) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (8aS,12aS,13aS)-3-hexoxy-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | (8aS,12aS,13aS)-3-hexoxy-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 57155393 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (8aS,12aS,13aS)-3-hexoxy-5,6,8a,9,10,11,12,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | CCCCCCOc1ccc2c(c1)CCN1C(=O)[C@H]3CCCN[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C22H32N2O2/c1-2-3-4-5-13-26-17-8-9-18-16(14-17)10-12-24-21(18)15-20-19(22(24)25)7-6-11-23-20/h8-9,14,19-21,23H,2-7,10-13,15H2,1H3/t19-,20-,21-/m0/s1 |
| InChIKey | DTBJHRULUARMLB-ACRUOGEOSA-N |
| XLogP | 3.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|