C12H20N6O7PS2+ — CID 57155467
bis[3-methylsulfonyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium (PubChem CID 57155467) has the molecular formula C12H20N6O7PS2+ and a molecular weight of 455.44 g/mol. Its IUPAC name is bis[3-methylsulfonyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium.
| Compound Name | bis[3-methylsulfonyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57155467 |
| Molecular Formula | C12H20N6O7PS2+ |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | bis[3-methylsulfonyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
| SMILES | CS(=O)(=O)C(CCO[P+](=O)OCCC(c1ncn[nH]1)S(C)(=O)=O)c1ncn[nH]1 |
| InChI | InChI=1S/C12H20N6O7PS2/c1-27(20,21)9(11-13-7-15-17-11)3-5-24-26(19)25-6-4-10(28(2,22)23)12-14-8-16-18-12/h7-10H,3-6H2,1-2H3,(H,13,15,17)(H,14,16,18)/q+1 |
| InChIKey | UFHLRDNNEQYSBH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|