C26H40N2O4 — CID 57155973
3,4-dibutyl-1-[2-(3,4-dibutyl-2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione (PubChem CID 57155973) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 3,4-dibutyl-1-[2-(3,4-dibutyl-2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dibutyl-1-[2-(3,4-dibutyl-2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57155973 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 3,4-dibutyl-1-[2-(3,4-dibutyl-2,5-dioxopyrrol-1-yl)ethyl]pyrrole-2,5-dione |
| SMILES | CCCCC1=C(CCCC)C(=O)N(CCN2C(=O)C(CCCC)=C(CCCC)C2=O)C1=O |
| InChI | InChI=1S/C26H40N2O4/c1-5-9-13-19-20(14-10-6-2)24(30)27(23(19)29)17-18-28-25(31)21(15-11-7-3)22(26(28)32)16-12-8-4/h5-18H2,1-4H3 |
| InChIKey | NIFJTJXQKYBEES-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|