About (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite
(4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite (PubChem CID 57156379) has the molecular formula C9H7ClO2S
and a molecular weight of 214.67 g/mol. Its IUPAC name is (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite.
Molecular Properties
| Compound Name | (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite |
| PubChem CID | 57156379 |
| Molecular Formula | C9H7ClO2S |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite |
| SMILES | O=C1CCOc2ccc(SCl)cc21 |
| InChI | InChI=1S/C9H7ClO2S/c10-13-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| InChIKey | ZZHBAQPMVBUFNJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite?
The IUPAC name of (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite (CID 57156379) is (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite.
What is the SMILES notation for (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite?
The canonical SMILES for (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite is O=C1CCOc2ccc(SCl)cc21.
What is the InChIKey of (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite?
The InChIKey is ZZHBAQPMVBUFNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO2S/c10-13-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2.
What are the key properties of (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite?
(4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite has a molecular weight of 214.67 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-2,3-dihydrochromen-6-yl) thiohypochlorite is sourced from PubChem (CID 57156379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).