About 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol
1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol (PubChem CID 57156444) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol.
Molecular Properties
| Compound Name | 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol |
| PubChem CID | 57156444 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol |
| SMILES | CC(O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O/c1-4(9-5(2)11)6-7-3-8-10-6/h3-5,9,11H,1-2H3,(H,7,8,10) |
| InChIKey | NDCJMULPCOLZCE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol?
The IUPAC name of 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol (CID 57156444) is 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol.
What is the SMILES notation for 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol?
The canonical SMILES for 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol is CC(O)NC(C)c1ncn[nH]1.
What is the InChIKey of 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol?
The InChIKey is NDCJMULPCOLZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-4(9-5(2)11)6-7-3-8-10-6/h3-5,9,11H,1-2H3,(H,7,8,10).
What are the key properties of 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol?
1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol has a molecular weight of 156.19 g/mol, XLogP of -0.21, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanol is sourced from PubChem (CID 57156444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).