C10H12N2O4S — CID 57156490
O-(4-methoxy-2-nitrophenyl) N,N-dimethylcarbamothioate (PubChem CID 57156490) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is O-(4-methoxy-2-nitrophenyl) N,N-dimethylcarbamothioate.
| Compound Name | O-(4-methoxy-2-nitrophenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 57156490 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | O-(4-methoxy-2-nitrophenyl) N,N-dimethylcarbamothioate |
| SMILES | COc1ccc(OC(=S)N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O4S/c1-11(2)10(17)16-9-5-4-7(15-3)6-8(9)12(13)14/h4-6H,1-3H3 |
| InChIKey | RXGJROHIBGQYCW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|