About 3-heptoxy-2-oxopropanal
3-heptoxy-2-oxopropanal (PubChem CID 57156554) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-heptoxy-2-oxopropanal.
Molecular Properties
| Compound Name | 3-heptoxy-2-oxopropanal |
| PubChem CID | 57156554 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 3-heptoxy-2-oxopropanal |
| SMILES | CCCCCCCOCC(=O)C=O |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-7-13-9-10(12)8-11/h8H,2-7,9H2,1H3 |
| InChIKey | LZOFYOKNSIOZIL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-heptoxy-2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptoxy-2-oxopropanal?
The IUPAC name of 3-heptoxy-2-oxopropanal (CID 57156554) is 3-heptoxy-2-oxopropanal.
What is the SMILES notation for 3-heptoxy-2-oxopropanal?
The canonical SMILES for 3-heptoxy-2-oxopropanal is CCCCCCCOCC(=O)C=O.
What is the InChIKey of 3-heptoxy-2-oxopropanal?
The InChIKey is LZOFYOKNSIOZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-2-3-4-5-6-7-13-9-10(12)8-11/h8H,2-7,9H2,1H3.
What are the key properties of 3-heptoxy-2-oxopropanal?
3-heptoxy-2-oxopropanal has a molecular weight of 186.25 g/mol, XLogP of 1.74, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptoxy-2-oxopropanal is sourced from PubChem (CID 57156554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).