About 5-phenyl-1,3,5-dioxazinane
5-phenyl-1,3,5-dioxazinane (PubChem CID 57157399) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-phenyl-1,3,5-dioxazinane.
Molecular Properties
| Compound Name | 5-phenyl-1,3,5-dioxazinane |
| PubChem CID | 57157399 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5-phenyl-1,3,5-dioxazinane |
| SMILES | c1ccc(N2COCOC2)cc1 |
| InChI | InChI=1S/C9H11NO2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h1-5H,6-8H2 |
| InChIKey | VJCQDNCTWGZCPJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-1,3,5-dioxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,3,5-dioxazinane?
The IUPAC name of 5-phenyl-1,3,5-dioxazinane (CID 57157399) is 5-phenyl-1,3,5-dioxazinane.
What is the SMILES notation for 5-phenyl-1,3,5-dioxazinane?
The canonical SMILES for 5-phenyl-1,3,5-dioxazinane is c1ccc(N2COCOC2)cc1.
What is the InChIKey of 5-phenyl-1,3,5-dioxazinane?
The InChIKey is VJCQDNCTWGZCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h1-5H,6-8H2.
What are the key properties of 5-phenyl-1,3,5-dioxazinane?
5-phenyl-1,3,5-dioxazinane has a molecular weight of 165.19 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3,5-dioxazinane is sourced from PubChem (CID 57157399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).