C30H35N3O4 — CID 57157539
2-[(2-formamido-3-naphthalen-2-ylpropanoyl)-methylamino]-N-(3-hydroxycyclohexyl)-3-phenylpropanamide (PubChem CID 57157539) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[(2-formamido-3-naphthalen-2-ylpropanoyl)-methylamino]-N-(3-hydroxycyclohexyl)-3-phenylpropanamide.
| Compound Name | 2-[(2-formamido-3-naphthalen-2-ylpropanoyl)-methylamino]-N-(3-hydroxycyclohexyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 57157539 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2-[(2-formamido-3-naphthalen-2-ylpropanoyl)-methylamino]-N-(3-hydroxycyclohexyl)-3-phenylpropanamide |
| SMILES | CN(C(=O)C(Cc1ccc2ccccc2c1)NC=O)C(Cc1ccccc1)C(=O)NC1CCCC(O)C1 |
| InChI | InChI=1S/C30H35N3O4/c1-33(30(37)27(31-20-34)17-22-14-15-23-10-5-6-11-24(23)16-22)28(18-21-8-3-2-4-9-21)29(36)32-25-12-7-13-26(35)19-25/h2-6,8-11,14-16,20,25-28,35H,7,12-13,17-19H2,1H3,(H,31,34)(H,32,36) |
| InChIKey | DTZPAIKNSPQCQR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|