About 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one
2-hydroxy-3,5-dihydro-2H-naphthalen-1-one (PubChem CID 57157710) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one |
| PubChem CID | 57157710 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1C2=CC=CCC2=CCC1O |
| InChI | InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-2,4-5,9,11H,3,6H2 |
| InChIKey | QPMKMQMAAIJFMC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one?
The IUPAC name of 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one (CID 57157710) is 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one is O=C1C2=CC=CCC2=CCC1O.
What is the InChIKey of 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one?
The InChIKey is QPMKMQMAAIJFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-2,4-5,9,11H,3,6H2.
What are the key properties of 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one?
2-hydroxy-3,5-dihydro-2H-naphthalen-1-one has a molecular weight of 162.19 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,5-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 57157710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).