C11H11F3N2O4 — CID 571582
ethyl 3,3,3-trifluoro-2-hydroxy-2-(pyridine-3-carbonylamino)propanoate (PubChem CID 571582) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-hydroxy-2-(pyridine-3-carbonylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-(pyridine-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 571582 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-(pyridine-3-carbonylamino)propanoate |
| SMILES | CCOC(=O)C(O)(NC(=O)c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O4/c1-2-20-9(18)10(19,11(12,13)14)16-8(17)7-4-3-5-15-6-7/h3-6,19H,2H2,1H3,(H,16,17) |
| InChIKey | XLSNZNXIGXZYRF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|