C20H29N3O8 — CID 57158422
[4-[1-ethoxy-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl]-6-prop-2-enoyloxyheptan-2-yl] prop-2-enoate (PubChem CID 57158422) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is [4-[1-ethoxy-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl]-6-prop-2-enoyloxyheptan-2-yl] prop-2-enoate.
| Compound Name | [4-[1-ethoxy-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl]-6-prop-2-enoyloxyheptan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 57158422 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [4-[1-ethoxy-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl]-6-prop-2-enoyloxyheptan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CC(CC(C)OC(=O)C=C)C(Cn1c(=O)[nH]c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C20H29N3O8/c1-6-16(24)30-12(4)9-14(10-13(5)31-17(25)7-2)15(29-8-3)11-23-19(27)21-18(26)22-20(23)28/h6-7,12-15H,1-2,8-11H2,3-5H3,(H2,21,22,26,27,28) |
| InChIKey | UVCCJAYVKSQUDT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|