C16H30N2O2 — CID 57158461
5-hydroxy-2,6,6-trimethyl-4,4-bis(propylamino)cyclohept-2-en-1-one (PubChem CID 57158461) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 5-hydroxy-2,6,6-trimethyl-4,4-bis(propylamino)cyclohept-2-en-1-one.
| Compound Name | 5-hydroxy-2,6,6-trimethyl-4,4-bis(propylamino)cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 57158461 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 5-hydroxy-2,6,6-trimethyl-4,4-bis(propylamino)cyclohept-2-en-1-one |
| SMILES | CCCNC1(NCCC)C=C(C)C(=O)CC(C)(C)C1O |
| InChI | InChI=1S/C16H30N2O2/c1-6-8-17-16(18-9-7-2)10-12(3)13(19)11-15(4,5)14(16)20/h10,14,17-18,20H,6-9,11H2,1-5H3 |
| InChIKey | GRXCPRRGRDEFMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|