C25H37N7 — CID 57158481
2-N-ethyl-2-N-[3-[ethyl(3-phenylprop-2-enyl)amino]propyl]-4-N,6-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 57158481) has the molecular formula C25H37N7 and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-N-ethyl-2-N-[3-[ethyl(3-phenylprop-2-enyl)amino]propyl]-4-N,6-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-ethyl-2-N-[3-[ethyl(3-phenylprop-2-enyl)amino]propyl]-4-N,6-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 57158481 |
| Molecular Formula | C25H37N7 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 2-N-ethyl-2-N-[3-[ethyl(3-phenylprop-2-enyl)amino]propyl]-4-N,6-N-bis(prop-2-enyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N(CC)CCCN(CC)CC=Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H37N7/c1-5-17-26-23-28-24(27-18-6-2)30-25(29-23)32(8-4)21-13-20-31(7-3)19-12-16-22-14-10-9-11-15-22/h5-6,9-12,14-16H,1-2,7-8,13,17-21H2,3-4H3,(H2,26,27,28,29,30) |
| InChIKey | PTFUFDQUUWPVJT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|